Table of Contents
What is the geometry of Ni DMG 2?
The geometry of the nickel(II) ion is square planar. It is surrounded by two equivalents of the conjugate base (dmgH−) of dimethylglyoxime (dmgH2). The pair of organic ligands are joined through hydrogen bonds to give a macrocyclic ligand.
What is the coordination number of Ni -( DMG 2 ]?
DMG is a bidentate ligand. So the coordination number of Ni in the given compound is 4.
What is the geometry of Ni DMG complex?
has a tetrahedral geometry and is paramagnetic in nature.
What is the Valency of nickel in n DMG complex?
Here, we can see that when Ni2+ reacts with dmgH2, a Ni-dmg complex is formed having two hydrogen bonds (also as the valency of nickel is 2 in ionic form).
What is the molar mass of Ni DMG 2?
288.91 g/mol.
molar mass of Ni(DMG)2, C8H14N4NiO4, is 288.91 g/mol.
What is the chemical formula for Ni DMG 2?
Chemical Identifiers
| Linear Formula | Ni(HC4H6N2O2)2 |
|---|---|
| EC No. | 236-782-7 |
| Pubchem CID | 5483625 |
| IUPAC Name | nickel(2+); (Z)-3-nitroso-N-oxidobut-2-en-2-amine |
| SMILES | CC(=C(C)N=O)N[O-].CC(=C(C)N=O)N[O-].[Ni+2] |
What is the mass of Ni?
58.6934 u
Nickel/Atomic mass
What is the Colour of Ni DMG 2 precipitate?
red cherry
The chelation reaction of nickel ions with the organic bidentate ligand dimethylglyoxime (DMG)1 in an alkaline ammonia medium producing nickel dimethylglyoxime, Ni(DMG)2, a red cherry or raspberry colour precipitate has been known since 1905 when it was discovered by Russian chemist Lev Aleksandrovich Chugaev (see …
What is the formula of DMG?
C4H8N2O2
Dimethylglyoxime/Formula
What is the protons of NI?
28
Nickel/Atomic number
A typical nickel atom has 28 electrons (negative charges) surrounding a nucleus of 28 protons (positively charged nucleons) and 30 neutrons (neutral nucleons).