Table of Contents
- 1 What is the structure of 3 chloro 4 methyl hexane?
- 2 What is the structure of 4 Ethyl 3 Methyloctane?
- 3 What is the structure of 2 chloro 3 Methylpentane?
- 4 What is the structure of 4 Ethyl 3 Methylheptane?
- 5 What is the structural formula of 4 Ethyl 3 Methylheptane?
- 6 What is the Iupac name of c6 h5 O c6 h5?
- 7 What is the molecular formula of c7h13cl?
What is the structure of 3 chloro 4 methyl hexane?
3-Chloro-4-methylhexane | C7H15Cl | ChemSpider.
What is the structure of 3 chloro?
3-Chloro-1-butyne
| PubChem CID | 30443 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C4H5Cl |
| Synonyms | 3-CHLORO-1-BUTYNE 21020-24-6 3-Chlorobut-1-yne 1-Butyne, 3-chloro- EINECS 244-151-2 More… |
What is the structure of 4 Ethyl 3 Methyloctane?
Octane, 4-ethyl-3-methyl
| PubChem CID | 530232 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C11H24 |
| Synonyms | Octane, 4-ethyl-3-methyl 4-ethyl-3-methyloctane DTXSID30336228 62016-20-0 |
| Molecular Weight | 156.31 |
What is the correct structure of 4 Ethyl 2 Methylheptane?
Identification of (4S)-4-ethyl-2-methylheptane Chemical Compound
| Chemical Formula | C10H22 |
|---|---|
| IUPAC Name | (4S)-4-ethyl-2-methylheptane |
| SMILES String | CCCC(CC)CC(C)C |
| InChI | InChI=1S/C10H22/c1-5-7-10(6-2)8-9(3)4/h9-10H,5-8H2,1-4H3/t10-/m0/s1 |
| InChIKey | OJDKRASKNKPYDH-JTQLQIEISA-N |
What is the structure of 2 chloro 3 Methylpentane?
C6H13Cl
2-Chloro-3-methylpentane | C6H13Cl – PubChem.
What is the structure of 1 chloro 4 Ethylcyclohexane?
1-chloro-4-ethylcyclohexane
| Compound number: | MolPort-005-231-518 |
|---|---|
| SMILES: | CCC1CCC(Cl)CC1 |
| InChI key: | YFVFYSHPWOURIP-UHFFFAOYSA-N |
| Molecular formula: | C8H15Cl |
| Molecular weight: | 146.66 |
What is the structure of 4 Ethyl 3 Methylheptane?
4-Ethyl-3-methylheptane | C10H22 | ChemSpider.
What is the structural formula of 4 methyl 2 Pentyne?
C6H10
4-Methyl-2-pentyne | C6H10 – PubChem.
What is the structural formula of 4 Ethyl 3 Methylheptane?
C10H22
4-Ethyl-3-methylheptane | C10H22 | ChemSpider.
What is the structure of 2 ethyl 3 methyl pentane?
2-methyl-3-ethylpentane | C8H18 | ChemSpider.
What is the Iupac name of c6 h5 O c6 h5?
DIPHENYL ETHER
Diphenyl ether
| PubChem CID | 7583 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C12H10O or C6H5OC6H5 or (C6H5)2O |
| Synonyms | DIPHENYL ETHER Diphenyl oxide 101-84-8 Phenoxybenzene Phenyl ether More… |
What is the formula for 4-chloro-1-ethyl-2-methylcyclohexane?
4-Chloro-1-ethyl-2-methylcyclohexane. PubChem CID. 118913366. Structure. Find Similar Structures. Molecular Formula. C9H17Cl. Synonyms.
What is the molecular formula of c7h13cl?
Molecular Formula. C7H13Cl. Synonyms. 1-Chloro-4-methylcyclohexane. 931-68-0. Cyclohexane, 1-chloro-4-methyl-. 4-Chlor-1-methylcyclohexan. SCHEMBL254832. More…
What is a synonym for c7h13cl?
C7H13Cl. Synonyms. 1-Chloro-1-methylcyclohexane. 931-78-2. NSC63061. 1-methylcyclohexyl chloride. 2-methyl-2-chlorocyclohexane. More… Molecular Weight.